C24H26O4 — CID 7514478
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl adamantane-1-carboxylate (PubChem CID 7514478) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl adamantane-1-carboxylate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 7514478 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl adamantane-1-carboxylate |
| SMILES | O=C(OCc1cc(=O)oc2cc3c(cc12)CCC3)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H26O4/c25-22-9-19(20-7-17-2-1-3-18(17)8-21(20)28-22)13-27-23(26)24-10-14-4-15(11-24)6-16(5-14)12-24/h7-9,14-16H,1-6,10-13H2 |
| InChIKey | GZIYYUSBLYOMQA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|