C28H34N2O3 — CID 55477960
4-[[4-(adamantane-1-carbonyl)piperazin-1-yl]methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one (PubChem CID 55477960) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is 4-[[4-(adamantane-1-carbonyl)piperazin-1-yl]methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one.
| Compound Name | 4-[[4-(adamantane-1-carbonyl)piperazin-1-yl]methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one |
|---|---|
| PubChem CID | 55477960 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 4-[[4-(adamantane-1-carbonyl)piperazin-1-yl]methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one |
| SMILES | O=C(N1CCN(Cc2cc(=O)oc3cc4c(cc23)CCC4)CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H34N2O3/c31-26-13-23(24-11-21-2-1-3-22(21)12-25(24)33-26)17-29-4-6-30(7-5-29)27(32)28-14-18-8-19(15-28)10-20(9-18)16-28/h11-13,18-20H,1-10,14-17H2 |
| InChIKey | KOSSCDVXDBOLJY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|