C27H34N2O4 — CID 46262763
4-[[4-[2-(1-adamantyl)acetyl]piperazin-1-yl]methyl]-6-methoxychromen-2-one (PubChem CID 46262763) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 4-[[4-[2-(1-adamantyl)acetyl]piperazin-1-yl]methyl]-6-methoxychromen-2-one.
| Compound Name | 4-[[4-[2-(1-adamantyl)acetyl]piperazin-1-yl]methyl]-6-methoxychromen-2-one |
|---|---|
| PubChem CID | 46262763 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 4-[[4-[2-(1-adamantyl)acetyl]piperazin-1-yl]methyl]-6-methoxychromen-2-one |
| SMILES | COc1ccc2oc(=O)cc(CN3CCN(C(=O)CC45CC6CC(CC(C6)C4)C5)CC3)c2c1 |
| InChI | InChI=1S/C27H34N2O4/c1-32-22-2-3-24-23(12-22)21(11-26(31)33-24)17-28-4-6-29(7-5-28)25(30)16-27-13-18-8-19(14-27)10-20(9-18)15-27/h2-3,11-12,18-20H,4-10,13-17H2,1H3 |
| InChIKey | WJIBAASQTUEOMX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|