C22H27NO3 — CID 9265799
4-[(1-adamantylmethylamino)methyl]-7-methoxychromen-2-one (PubChem CID 9265799) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 4-[(1-adamantylmethylamino)methyl]-7-methoxychromen-2-one.
| Compound Name | 4-[(1-adamantylmethylamino)methyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 9265799 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-[(1-adamantylmethylamino)methyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(CNCC34CC5CC(CC(C5)C3)C4)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H27NO3/c1-25-18-2-3-19-17(7-21(24)26-20(19)8-18)12-23-13-22-9-14-4-15(10-22)6-16(5-14)11-22/h2-3,7-8,14-16,23H,4-6,9-13H2,1H3 |
| InChIKey | SENMOQZFMDSXRU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|