C21H21ClO5 — CID 9271046
(7-hydroxy-2-oxochromen-4-yl)methyl (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 9271046) has the molecular formula C21H21ClO5 and a molecular weight of 388.85 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 9271046 |
| Molecular Formula | C21H21ClO5 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | O=C(OCc1cc(=O)oc2cc(O)ccc12)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C21H21ClO5/c22-21-8-12-3-13(9-21)7-20(6-12,11-21)19(25)26-10-14-4-18(24)27-17-5-15(23)1-2-16(14)17/h1-2,4-5,12-13,23H,3,6-11H2/t12-,13+,20?,21? |
| InChIKey | LTIZGUZNJQCUDH-GWEVUABKSA-N |
| XLogP | 4.12 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|