C24H27NO6 — CID 8888752
(7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate (PubChem CID 8888752) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8888752 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate |
| SMILES | C[C@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)OCc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C24H27NO6/c1-13(25-23(29)24-9-14-4-15(10-24)6-16(5-14)11-24)22(28)30-12-17-7-21(27)31-20-8-18(26)2-3-19(17)20/h2-3,7-8,13-16,26H,4-6,9-12H2,1H3,(H,25,29)/t13-,14?,15?,16?,24?/m0/s1 |
| InChIKey | NUYFFAFNRJVXLH-ZBNOLQPOSA-N |
| XLogP | 3.26 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|