About (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate
(4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate (PubChem CID 8888613) has the molecular formula C22H29NO3
and a molecular weight of 355.48 g/mol. Its IUPAC name is (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate.
Molecular Properties
| Compound Name | (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate |
| PubChem CID | 8888613 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate |
| SMILES | Cc1ccc(COC(=O)[C@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H29NO3/c1-14-3-5-16(6-4-14)13-26-20(24)15(2)23-21(25)22-10-17-7-18(11-22)9-19(8-17)12-22/h3-6,15,17-19H,7-13H2,1-2H3,(H,23,25)/t15-,17?,18?,19?,22?/m0/s1 |
| InChIKey | YQCKHUAQBLQHOV-PFAOJVKKSA-N |
| XLogP | 3.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate?
The IUPAC name of (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate (CID 8888613) is (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate.
What is the SMILES notation for (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate?
The canonical SMILES for (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate is Cc1ccc(COC(=O)[C@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)cc1.
What is the InChIKey of (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate?
The InChIKey is YQCKHUAQBLQHOV-PFAOJVKKSA-N. The full InChI is InChI=1S/C22H29NO3/c1-14-3-5-16(6-4-14)13-26-20(24)15(2)23-21(25)22-10-17-7-18(11-22)9-19(8-17)12-22/h3-6,15,17-19H,7-13H2,1-2H3,(H,23,25)/t15-,17?,18?,19?,22?/m0/s1.
What are the key properties of (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate?
(4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate has a molecular weight of 355.48 g/mol, XLogP of 3.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate is sourced from PubChem (CID 8888613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).