C22H29NO3 — CID 8888613
(4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate (PubChem CID 8888613) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate.
| Compound Name | (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8888613 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (4-methylphenyl)methyl (2S)-2-(adamantane-1-carbonylamino)propanoate |
| SMILES | Cc1ccc(COC(=O)[C@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H29NO3/c1-14-3-5-16(6-4-14)13-26-20(24)15(2)23-21(25)22-10-17-7-18(11-22)9-19(8-17)12-22/h3-6,15,17-19H,7-13H2,1-2H3,(H,23,25)/t15-,17?,18?,19?,22?/m0/s1 |
| InChIKey | YQCKHUAQBLQHOV-PFAOJVKKSA-N |
| XLogP | 3.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |