C22H33N3O5 — CID 8888670
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] (2S)-2-(adamantane-1-carbonylamino)propanoate (PubChem CID 8888670) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (2S)-2-(adamantane-1-carbonylamino)propanoate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (2S)-2-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8888670 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (2S)-2-(adamantane-1-carbonylamino)propanoate |
| SMILES | C[C@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)OCC(=O)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C22H33N3O5/c1-13(19(27)30-12-18(26)25-21(29)24-17-4-2-3-5-17)23-20(28)22-9-14-6-15(10-22)8-16(7-14)11-22/h13-17H,2-12H2,1H3,(H,23,28)(H2,24,25,26,29)/t13-,14?,15?,16?,22?/m0/s1 |
| InChIKey | XMYMSYCCXCFZQD-QRYOHXEKSA-N |
| XLogP | 2.02 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |