C19H27ClN2O4 — CID 7447942
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 7447942) has the molecular formula C19H27ClN2O4 and a molecular weight of 382.89 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7447942 |
| Molecular Formula | C19H27ClN2O4 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C19H27ClN2O4/c20-19-8-12-5-13(9-19)7-18(6-12,11-19)16(24)26-10-15(23)22-17(25)21-14-3-1-2-4-14/h12-14H,1-11H2,(H2,21,22,23,25)/t12-,13+,18?,19? |
| InChIKey | XKMVHPGQDYDDJT-NFAYLAGKSA-N |
| XLogP | 2.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|