C20H31ClN2O2 — CID 23350542
(5S,7S)-3-chloro-N-[2-(cycloheptylamino)-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 23350542) has the molecular formula C20H31ClN2O2 and a molecular weight of 366.93 g/mol. Its IUPAC name is (5S,7S)-3-chloro-N-[2-(cycloheptylamino)-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | (5S,7S)-3-chloro-N-[2-(cycloheptylamino)-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 23350542 |
| Molecular Formula | C20H31ClN2O2 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (5S,7S)-3-chloro-N-[2-(cycloheptylamino)-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | O=C(CNC(=O)C12C[C@@H]3C[C@H](CC(Cl)(C3)C1)C2)NC1CCCCCC1 |
| InChI | InChI=1S/C20H31ClN2O2/c21-20-10-14-7-15(11-20)9-19(8-14,13-20)18(25)22-12-17(24)23-16-5-3-1-2-4-6-16/h14-16H,1-13H2,(H,22,25)(H,23,24)/t14-,15-,19?,20?/m0/s1 |
| InChIKey | WXKMGYQBMJJFDX-XSYNCLLFSA-N |
| XLogP | 3.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|