C15H20ClF3N2O2 — CID 7535378
(5S,7S)-3-chloro-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]adamantane-1-carboxamide (PubChem CID 7535378) has the molecular formula C15H20ClF3N2O2 and a molecular weight of 352.78 g/mol. Its IUPAC name is (5S,7S)-3-chloro-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]adamantane-1-carboxamide.
| Compound Name | (5S,7S)-3-chloro-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7535378 |
| Molecular Formula | C15H20ClF3N2O2 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (5S,7S)-3-chloro-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]adamantane-1-carboxamide |
| SMILES | O=C(CNC(=O)C12C[C@@H]3C[C@H](CC(Cl)(C3)C1)C2)NCC(F)(F)F |
| InChI | InChI=1S/C15H20ClF3N2O2/c16-14-4-9-1-10(5-14)3-13(2-9,7-14)12(23)20-6-11(22)21-8-15(17,18)19/h9-10H,1-8H2,(H,20,23)(H,21,22)/t9-,10-,13?,14?/m0/s1 |
| InChIKey | ZTAAQWVQFGFDFI-MBFGLIKCSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|