C20H23ClF2N2O3 — CID 9404995
(5S,7R)-3-chloro-N-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 9404995) has the molecular formula C20H23ClF2N2O3 and a molecular weight of 412.86 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 9404995 |
| Molecular Formula | C20H23ClF2N2O3 |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (5S,7R)-3-chloro-N-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | O=C(CNC(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H23ClF2N2O3/c21-20-8-12-5-13(9-20)7-19(6-12,11-20)17(27)24-10-16(26)25-14-1-3-15(4-2-14)28-18(22)23/h1-4,12-13,18H,5-11H2,(H,24,27)(H,25,26)/t12-,13+,19?,20? |
| InChIKey | JZUKOSAIHLTPAQ-BRRVFRNMSA-N |
| XLogP | 3.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|