C23H24ClNO2 — CID 7914982
(5S,7R)-3-chloro-N-(4-phenoxyphenyl)adamantane-1-carboxamide (PubChem CID 7914982) has the molecular formula C23H24ClNO2 and a molecular weight of 381.90 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-(4-phenoxyphenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-(4-phenoxyphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7914982 |
| Molecular Formula | C23H24ClNO2 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (5S,7R)-3-chloro-N-(4-phenoxyphenyl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C23H24ClNO2/c24-23-13-16-10-17(14-23)12-22(11-16,15-23)21(26)25-18-6-8-20(9-7-18)27-19-4-2-1-3-5-19/h1-9,16-17H,10-15H2,(H,25,26)/t16-,17+,22?,23? |
| InChIKey | ILUPDOUXDDBGQH-WDXRGRCHSA-N |
| XLogP | 6.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|