C18H21ClN2O2 — CID 98390702
(5R,7R)-N'-benzoyl-3-chloroadamantane-1-carbohydrazide (PubChem CID 98390702) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is (5R,7R)-N'-benzoyl-3-chloroadamantane-1-carbohydrazide.
| Compound Name | (5R,7R)-N'-benzoyl-3-chloroadamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 98390702 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (5R,7R)-N'-benzoyl-3-chloroadamantane-1-carbohydrazide |
| SMILES | O=C(NNC(=O)C12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C18H21ClN2O2/c19-18-9-12-6-13(10-18)8-17(7-12,11-18)16(23)21-20-15(22)14-4-2-1-3-5-14/h1-5,12-13H,6-11H2,(H,20,22)(H,21,23)/t12-,13-,17?,18?/m1/s1 |
| InChIKey | XPVLRBASAJJZPO-LGBHXNNWSA-N |
| XLogP | 3.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|