C18H22N2O3 — CID 3146003
N'-(3-hydroxybenzoyl)adamantane-1-carbohydrazide (PubChem CID 3146003) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is N'-(3-hydroxybenzoyl)adamantane-1-carbohydrazide.
| Compound Name | N'-(3-hydroxybenzoyl)adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 3146003 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N'-(3-hydroxybenzoyl)adamantane-1-carbohydrazide |
| SMILES | O=C(NNC(=O)C12CC3CC(CC(C3)C1)C2)c1cccc(O)c1 |
| InChI | InChI=1S/C18H22N2O3/c21-15-3-1-2-14(7-15)16(22)19-20-17(23)18-8-11-4-12(9-18)6-13(5-11)10-18/h1-3,7,11-13,21H,4-6,8-10H2,(H,19,22)(H,20,23) |
| InChIKey | WTOKLMCARPLLFY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|