C20H25ClN2O2 — CID 7808940
(5S,7R)-3-chloro-N'-(2,4-dimethylbenzoyl)adamantane-1-carbohydrazide (PubChem CID 7808940) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N'-(2,4-dimethylbenzoyl)adamantane-1-carbohydrazide.
| Compound Name | (5S,7R)-3-chloro-N'-(2,4-dimethylbenzoyl)adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 7808940 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (5S,7R)-3-chloro-N'-(2,4-dimethylbenzoyl)adamantane-1-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)C23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)c(C)c1 |
| InChI | InChI=1S/C20H25ClN2O2/c1-12-3-4-16(13(2)5-12)17(24)22-23-18(25)19-7-14-6-15(8-19)10-20(21,9-14)11-19/h3-5,14-15H,6-11H2,1-2H3,(H,22,24)(H,23,25)/t14-,15+,19?,20? |
| InChIKey | GDHHVFOYQYKKAG-JNKARSBBSA-N |
| XLogP | 3.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|