C20H26ClNOS — CID 98643763
(5S,7S)-3-chloro-N-(3-phenylsulfanylpropyl)adamantane-1-carboxamide (PubChem CID 98643763) has the molecular formula C20H26ClNOS and a molecular weight of 363.95 g/mol. Its IUPAC name is (5S,7S)-3-chloro-N-(3-phenylsulfanylpropyl)adamantane-1-carboxamide.
| Compound Name | (5S,7S)-3-chloro-N-(3-phenylsulfanylpropyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98643763 |
| Molecular Formula | C20H26ClNOS |
| Molecular Weight | 363.95 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (5S,7S)-3-chloro-N-(3-phenylsulfanylpropyl)adamantane-1-carboxamide |
| SMILES | O=C(NCCCSc1ccccc1)C12C[C@@H]3C[C@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C20H26ClNOS/c21-20-12-15-9-16(13-20)11-19(10-15,14-20)18(23)22-7-4-8-24-17-5-2-1-3-6-17/h1-3,5-6,15-16H,4,7-14H2,(H,22,23)/t15-,16-,19?,20?/m0/s1 |
| InChIKey | PIQJKOLVGQWJDH-MVYVIFSASA-N |
| XLogP | 4.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.95 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|