C24H34N2O2S — CID 9483084
N-[(2R)-3-methyl-1-oxo-1-(2-phenylsulfanylethylamino)butan-2-yl]adamantane-1-carboxamide (PubChem CID 9483084) has the molecular formula C24H34N2O2S and a molecular weight of 414.62 g/mol. Its IUPAC name is N-[(2R)-3-methyl-1-oxo-1-(2-phenylsulfanylethylamino)butan-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[(2R)-3-methyl-1-oxo-1-(2-phenylsulfanylethylamino)butan-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 9483084 |
| Molecular Formula | C24H34N2O2S |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-[(2R)-3-methyl-1-oxo-1-(2-phenylsulfanylethylamino)butan-2-yl]adamantane-1-carboxamide |
| SMILES | CC(C)[C@@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)NCCSc1ccccc1 |
| InChI | InChI=1S/C24H34N2O2S/c1-16(2)21(22(27)25-8-9-29-20-6-4-3-5-7-20)26-23(28)24-13-17-10-18(14-24)12-19(11-17)15-24/h3-7,16-19,21H,8-15H2,1-2H3,(H,25,27)(H,26,28)/t17?,18?,19?,21-,24?/m1/s1 |
| InChIKey | IXRCZDUGJIZSLV-ZNKOEICNSA-N |
| XLogP | 4.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|