C20H24ClNO3 — CID 7758617
(5S,7R)-3-chloro-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]adamantane-1-carboxamide (PubChem CID 7758617) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7758617 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (5S,7R)-3-chloro-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]adamantane-1-carboxamide |
| SMILES | O=C(NC[C@@H]1COc2ccccc2O1)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C20H24ClNO3/c21-20-8-13-5-14(9-20)7-19(6-13,12-20)18(23)22-10-15-11-24-16-3-1-2-4-17(16)25-15/h1-4,13-15H,5-12H2,(H,22,23)/t13-,14+,15-,19?,20?/m1/s1 |
| InChIKey | ZAWJMHFLSGRYSZ-HMPNUMLOSA-N |
| XLogP | 3.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|