C21H26BrNO3 — CID 7758631
2-[(5S,7R)-3-bromo-1-adamantyl]-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]acetamide (PubChem CID 7758631) has the molecular formula C21H26BrNO3 and a molecular weight of 420.35 g/mol. Its IUPAC name is 2-[(5S,7R)-3-bromo-1-adamantyl]-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]acetamide.
| Compound Name | 2-[(5S,7R)-3-bromo-1-adamantyl]-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 7758631 |
| Molecular Formula | C21H26BrNO3 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-[(5S,7R)-3-bromo-1-adamantyl]-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]acetamide |
| SMILES | O=C(CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)NC[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C21H26BrNO3/c22-21-8-14-5-15(9-21)7-20(6-14,13-21)10-19(24)23-11-16-12-25-17-3-1-2-4-18(17)26-16/h1-4,14-16H,5-13H2,(H,23,24)/t14-,15+,16-,20?,21?/m1/s1 |
| InChIKey | NNMDLRNFMNCUJW-TVZLTPBZSA-N |
| XLogP | 4.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|