C16H19ClN2O3S — CID 5202139
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-chloroadamantane-1-carboxylate (PubChem CID 5202139) has the molecular formula C16H19ClN2O3S and a molecular weight of 354.86 g/mol. Its IUPAC name is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-chloroadamantane-1-carboxylate.
| Compound Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 5202139 |
| Molecular Formula | C16H19ClN2O3S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-chloroadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(Cl)(C3)C1)C2)Nc1nccs1 |
| InChI | InChI=1S/C16H19ClN2O3S/c17-16-6-10-3-11(7-16)5-15(4-10,9-16)13(21)22-8-12(20)19-14-18-1-2-23-14/h1-2,10-11H,3-9H2,(H,18,19,20) |
| InChIKey | IMQDUVOEJZIHCX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|