C20H27N3O5 — CID 8882621
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate (PubChem CID 8882621) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 8882621 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)OCC(=O)NC(=O)NC1CC1 |
| InChI | InChI=1S/C20H27N3O5/c1-12(18(26)28-11-16(24)23-19(27)22-15-9-10-15)21-17(25)13-5-7-14(8-6-13)20(2,3)4/h5-8,12,15H,9-11H2,1-4H3,(H,21,25)(H2,22,23,24,27)/t12-/m0/s1 |
| InChIKey | XWJKUBRPUMHYTM-LBPRGKRZSA-N |
| XLogP | 1.63 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |