C19H24N2O4 — CID 8882676
[2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate (PubChem CID 8882676) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 8882676 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate |
| SMILES | C#CCNC(=O)COC(=O)[C@H](C)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H24N2O4/c1-6-11-20-16(22)12-25-18(24)13(2)21-17(23)14-7-9-15(10-8-14)19(3,4)5/h1,7-10,13H,11-12H2,2-5H3,(H,20,22)(H,21,23)/t13-/m0/s1 |
| InChIKey | UWFWXBRYZDRXFA-ZDUSSCGKSA-N |
| XLogP | 1.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|