C19H24N2O4 — CID 122152382
methyl 2-[[2-[(4-tert-butylbenzoyl)amino]acetyl]amino]pent-4-ynoate (PubChem CID 122152382) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is methyl 2-[[2-[(4-tert-butylbenzoyl)amino]acetyl]amino]pent-4-ynoate.
| Compound Name | methyl 2-[[2-[(4-tert-butylbenzoyl)amino]acetyl]amino]pent-4-ynoate |
|---|---|
| PubChem CID | 122152382 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | methyl 2-[[2-[(4-tert-butylbenzoyl)amino]acetyl]amino]pent-4-ynoate |
| SMILES | C#CCC(NC(=O)CNC(=O)c1ccc(C(C)(C)C)cc1)C(=O)OC |
| InChI | InChI=1S/C19H24N2O4/c1-6-7-15(18(24)25-5)21-16(22)12-20-17(23)13-8-10-14(11-9-13)19(2,3)4/h1,8-11,15H,7,12H2,2-5H3,(H,20,23)(H,21,22) |
| InChIKey | MANMLEMNNPKGGR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|