C22H32N2O6 — CID 18280210
methyl 2-[[2-[2-[(4-tert-butylbenzoyl)amino]acetyl]oxyacetyl]amino]-3-methylpentanoate (PubChem CID 18280210) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is methyl 2-[[2-[2-[(4-tert-butylbenzoyl)amino]acetyl]oxyacetyl]amino]-3-methylpentanoate.
| Compound Name | methyl 2-[[2-[2-[(4-tert-butylbenzoyl)amino]acetyl]oxyacetyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 18280210 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | methyl 2-[[2-[2-[(4-tert-butylbenzoyl)amino]acetyl]oxyacetyl]amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)COC(=O)CNC(=O)c1ccc(C(C)(C)C)cc1)C(=O)OC |
| InChI | InChI=1S/C22H32N2O6/c1-7-14(2)19(21(28)29-6)24-17(25)13-30-18(26)12-23-20(27)15-8-10-16(11-9-15)22(3,4)5/h8-11,14,19H,7,12-13H2,1-6H3,(H,23,27)(H,24,25) |
| InChIKey | REXMGPIUYOEXQP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |