C19H26N2O6 — CID 46683960
methyl 4-methyl-2-[[2-[2-[(4-methylbenzoyl)amino]acetyl]oxyacetyl]amino]pentanoate (PubChem CID 46683960) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is methyl 4-methyl-2-[[2-[2-[(4-methylbenzoyl)amino]acetyl]oxyacetyl]amino]pentanoate.
| Compound Name | methyl 4-methyl-2-[[2-[2-[(4-methylbenzoyl)amino]acetyl]oxyacetyl]amino]pentanoate |
|---|---|
| PubChem CID | 46683960 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | methyl 4-methyl-2-[[2-[2-[(4-methylbenzoyl)amino]acetyl]oxyacetyl]amino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)COC(=O)CNC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H26N2O6/c1-12(2)9-15(19(25)26-4)21-16(22)11-27-17(23)10-20-18(24)14-7-5-13(3)6-8-14/h5-8,12,15H,9-11H2,1-4H3,(H,20,24)(H,21,22) |
| InChIKey | CAVBPEOBMIPIGZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |