C19H25NO7 — CID 8806342
methyl (2R)-2-[[2-[2-(4-acetylphenoxy)acetyl]oxyacetyl]amino]-4-methylpentanoate (PubChem CID 8806342) has the molecular formula C19H25NO7 and a molecular weight of 379.41 g/mol. Its IUPAC name is methyl (2R)-2-[[2-[2-(4-acetylphenoxy)acetyl]oxyacetyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[[2-[2-(4-acetylphenoxy)acetyl]oxyacetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 8806342 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | methyl (2R)-2-[[2-[2-(4-acetylphenoxy)acetyl]oxyacetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)COC(=O)COc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C19H25NO7/c1-12(2)9-16(19(24)25-4)20-17(22)10-27-18(23)11-26-15-7-5-14(6-8-15)13(3)21/h5-8,12,16H,9-11H2,1-4H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | ZQODLOYCQGHZKU-MRXNPFEDSA-N |
| XLogP | 1.52 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |