C16H22ClNO4 — CID 9289599
methyl (2S)-2-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]-4-methylpentanoate (PubChem CID 9289599) has the molecular formula C16H22ClNO4 and a molecular weight of 327.81 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 9289599 |
| Molecular Formula | C16H22ClNO4 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | methyl (2S)-2-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)COc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C16H22ClNO4/c1-10(2)7-14(16(20)21-4)18-15(19)9-22-12-5-6-13(17)11(3)8-12/h5-6,8,10,14H,7,9H2,1-4H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | LJJSQLZTJKTFRD-AWEZNQCLSA-N |
| XLogP | 2.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |