C18H23ClN4O3 — CID 86891237
2-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]-4-methyl-N-(1H-pyrazol-5-yl)pentanamide (PubChem CID 86891237) has the molecular formula C18H23ClN4O3 and a molecular weight of 378.86 g/mol. Its IUPAC name is 2-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]-4-methyl-N-(1H-pyrazol-5-yl)pentanamide.
| Compound Name | 2-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]-4-methyl-N-(1H-pyrazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 86891237 |
| Molecular Formula | C18H23ClN4O3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]-4-methyl-N-(1H-pyrazol-5-yl)pentanamide |
| SMILES | Cc1cc(OCC(=O)NC(CC(C)C)C(=O)Nc2ccn[nH]2)ccc1Cl |
| InChI | InChI=1S/C18H23ClN4O3/c1-11(2)8-15(18(25)22-16-6-7-20-23-16)21-17(24)10-26-13-4-5-14(19)12(3)9-13/h4-7,9,11,15H,8,10H2,1-3H3,(H,21,24)(H2,20,22,23,25) |
| InChIKey | GZHHUCKLOXNLPC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |