C24H28N2O5 — CID 7854460
[2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[(4-tert-butylbenzoyl)amino]acetate (PubChem CID 7854460) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[(4-tert-butylbenzoyl)amino]acetate.
| Compound Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[(4-tert-butylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7854460 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[(4-tert-butylbenzoyl)amino]acetate |
| SMILES | CCC(=O)Nc1ccc(C(=O)COC(=O)CNC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O5/c1-5-21(28)26-19-12-8-16(9-13-19)20(27)15-31-22(29)14-25-23(30)17-6-10-18(11-7-17)24(2,3)4/h6-13H,5,14-15H2,1-4H3,(H,25,30)(H,26,28) |
| InChIKey | ZSBGNXBDMFRYSI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |