C27H28N4O4 — CID 4655498
[2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-[(4-tert-butylbenzoyl)amino]acetate (PubChem CID 4655498) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-[(4-tert-butylbenzoyl)amino]acetate.
| Compound Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-[(4-tert-butylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 4655498 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-[(4-tert-butylbenzoyl)amino]acetate |
| SMILES | CC(C)(C)c1ccc(C(=O)NCC(=O)OCC(=O)Nc2ccc(/N=N/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H28N4O4/c1-27(2,3)20-11-9-19(10-12-20)26(34)28-17-25(33)35-18-24(32)29-21-13-15-23(16-14-21)31-30-22-7-5-4-6-8-22/h4-16H,17-18H2,1-3H3,(H,28,34)(H,29,32)/b31-30+ |
| InChIKey | QRUXEJFDLFGESR-NVQSTNCTSA-N |
| XLogP | 5.31 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|