C24H22N4O5 — CID 42970225
[2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-[(2-methoxybenzoyl)amino]acetate (PubChem CID 42970225) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-[(2-methoxybenzoyl)amino]acetate.
| Compound Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-[(2-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 42970225 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-[(2-methoxybenzoyl)amino]acetate |
| SMILES | COc1ccccc1C(=O)NCC(=O)OCC(=O)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N4O5/c1-32-21-10-6-5-9-20(21)24(31)25-15-23(30)33-16-22(29)26-17-11-13-19(14-12-17)28-27-18-7-3-2-4-8-18/h2-14H,15-16H2,1H3,(H,25,31)(H,26,29)/b28-27+ |
| InChIKey | QSQJTWINMFKGMQ-BYYHNAKLSA-N |
| XLogP | 4.02 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|