C19H16ClF3N2O5 — CID 35985498
[2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(2-methoxybenzoyl)amino]acetate (PubChem CID 35985498) has the molecular formula C19H16ClF3N2O5 and a molecular weight of 444.79 g/mol. Its IUPAC name is [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(2-methoxybenzoyl)amino]acetate.
| Compound Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(2-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 35985498 |
| Molecular Formula | C19H16ClF3N2O5 |
| Molecular Weight | 444.79 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(2-methoxybenzoyl)amino]acetate |
| SMILES | COc1ccccc1C(=O)NCC(=O)OCC(=O)Nc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C19H16ClF3N2O5/c1-29-14-8-3-2-5-11(14)18(28)24-9-16(27)30-10-15(26)25-17-12(19(21,22)23)6-4-7-13(17)20/h2-8H,9-10H2,1H3,(H,24,28)(H,25,26) |
| InChIKey | ONTDGGSTKSOSFH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |