C17H14Cl2N2O4 — CID 2625515
[2-(2,6-dichloroanilino)-2-oxoethyl] 2-benzamidoacetate (PubChem CID 2625515) has the molecular formula C17H14Cl2N2O4 and a molecular weight of 381.22 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl] 2-benzamidoacetate.
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 2625515 |
| Molecular Formula | C17H14Cl2N2O4 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 2-benzamidoacetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccccc1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H14Cl2N2O4/c18-12-7-4-8-13(19)16(12)21-14(22)10-25-15(23)9-20-17(24)11-5-2-1-3-6-11/h1-8H,9-10H2,(H,20,24)(H,21,22) |
| InChIKey | PNPHYPYFHBITMK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |