C17H15BrN2O4 — CID 2625531
[2-(2-bromoanilino)-2-oxoethyl] 2-benzamidoacetate (PubChem CID 2625531) has the molecular formula C17H15BrN2O4 and a molecular weight of 391.22 g/mol. Its IUPAC name is [2-(2-bromoanilino)-2-oxoethyl] 2-benzamidoacetate.
| Compound Name | [2-(2-bromoanilino)-2-oxoethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 2625531 |
| Molecular Formula | C17H15BrN2O4 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | [2-(2-bromoanilino)-2-oxoethyl] 2-benzamidoacetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccccc1)Nc1ccccc1Br |
| InChI | InChI=1S/C17H15BrN2O4/c18-13-8-4-5-9-14(13)20-15(21)11-24-16(22)10-19-17(23)12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,23)(H,20,21) |
| InChIKey | NRGOMWGRPHEFIU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |