C20H18ClF3N2O4 — CID 46819628
[2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 3-benzamidobutanoate (PubChem CID 46819628) has the molecular formula C20H18ClF3N2O4 and a molecular weight of 442.82 g/mol. Its IUPAC name is [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 3-benzamidobutanoate.
| Compound Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 3-benzamidobutanoate |
|---|---|
| PubChem CID | 46819628 |
| Molecular Formula | C20H18ClF3N2O4 |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 3-benzamidobutanoate |
| SMILES | CC(CC(=O)OCC(=O)Nc1c(Cl)cccc1C(F)(F)F)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18ClF3N2O4/c1-12(25-19(29)13-6-3-2-4-7-13)10-17(28)30-11-16(27)26-18-14(20(22,23)24)8-5-9-15(18)21/h2-9,12H,10-11H2,1H3,(H,25,29)(H,26,27) |
| InChIKey | VMSSCOLCZBMSQD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |