C22H26N2O5 — CID 42964669
[2-(4-tert-butylanilino)-2-oxoethyl] 2-[(2-phenoxyacetyl)amino]acetate (PubChem CID 42964669) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-2-oxoethyl] 2-[(2-phenoxyacetyl)amino]acetate.
| Compound Name | [2-(4-tert-butylanilino)-2-oxoethyl] 2-[(2-phenoxyacetyl)amino]acetate |
|---|---|
| PubChem CID | 42964669 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [2-(4-tert-butylanilino)-2-oxoethyl] 2-[(2-phenoxyacetyl)amino]acetate |
| SMILES | CC(C)(C)c1ccc(NC(=O)COC(=O)CNC(=O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-22(2,3)16-9-11-17(12-10-16)24-20(26)15-29-21(27)13-23-19(25)14-28-18-7-5-4-6-8-18/h4-12H,13-15H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | XBYGASAWYNBXOF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |