C21H29N3O4 — CID 24671340
[2-[(2-cyano-3-methylbutan-2-yl)amino]-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate (PubChem CID 24671340) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is [2-[(2-cyano-3-methylbutan-2-yl)amino]-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate.
| Compound Name | [2-[(2-cyano-3-methylbutan-2-yl)amino]-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 24671340 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | [2-[(2-cyano-3-methylbutan-2-yl)amino]-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate |
| SMILES | CC(C)C(C)(C#N)NC(=O)COC(=O)CNC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H29N3O4/c1-14(2)21(6,13-22)24-17(25)12-28-18(26)11-23-19(27)15-7-9-16(10-8-15)20(3,4)5/h7-10,14H,11-12H2,1-6H3,(H,23,27)(H,24,25) |
| InChIKey | USTCCPAJZSCTRA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |