C13H11Cl2NO3 — CID 20610296
methyl 2-[(2,6-dichlorobenzoyl)amino]pent-4-ynoate (PubChem CID 20610296) has the molecular formula C13H11Cl2NO3 and a molecular weight of 300.14 g/mol. Its IUPAC name is methyl 2-[(2,6-dichlorobenzoyl)amino]pent-4-ynoate.
| Compound Name | methyl 2-[(2,6-dichlorobenzoyl)amino]pent-4-ynoate |
|---|---|
| PubChem CID | 20610296 |
| Molecular Formula | C13H11Cl2NO3 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | methyl 2-[(2,6-dichlorobenzoyl)amino]pent-4-ynoate |
| SMILES | C#CCC(NC(=O)c1c(Cl)cccc1Cl)C(=O)OC |
| InChI | InChI=1S/C13H11Cl2NO3/c1-3-5-10(13(18)19-2)16-12(17)11-8(14)6-4-7-9(11)15/h1,4,6-7,10H,5H2,2H3,(H,16,17) |
| InChIKey | FMNPNOHEOYUGCS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|