C22H22Cl2N2O4 — CID 70123210
methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-6-(2,6-dimethylanilino)-6-oxohex-4-enoate (PubChem CID 70123210) has the molecular formula C22H22Cl2N2O4 and a molecular weight of 449.33 g/mol. Its IUPAC name is methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-6-(2,6-dimethylanilino)-6-oxohex-4-enoate.
| Compound Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-6-(2,6-dimethylanilino)-6-oxohex-4-enoate |
|---|---|
| PubChem CID | 70123210 |
| Molecular Formula | C22H22Cl2N2O4 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-6-(2,6-dimethylanilino)-6-oxohex-4-enoate |
| SMILES | COC(=O)[C@H](CC=CC(=O)Nc1c(C)cccc1C)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H22Cl2N2O4/c1-13-7-4-8-14(2)20(13)26-18(27)12-6-11-17(22(29)30-3)25-21(28)19-15(23)9-5-10-16(19)24/h4-10,12,17H,11H2,1-3H3,(H,25,28)(H,26,27)/t17-/m0/s1 |
| InChIKey | OZYJJZFYWOWYBI-KRWDZBQOSA-N |
| XLogP | 4.47 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|