About methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate
methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate (PubChem CID 66912040) has the molecular formula C29H24Cl2N4O3
and a molecular weight of 547.44 g/mol. Its IUPAC name is methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate.
Molecular Properties
| Compound Name | methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate |
| PubChem CID | 66912040 |
| Molecular Formula | C29H24Cl2N4O3 |
| Molecular Weight | 547.44 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate |
| SMILES | COC(=O)C(CC=Cc1ccc(N(c2ccccc2)c2ncccn2)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C29H24Cl2N4O3/c1-38-28(37)25(34-27(36)26-23(30)11-6-12-24(26)31)13-5-8-20-14-16-22(17-15-20)35(21-9-3-2-4-10-21)29-32-18-7-19-33-29/h2-12,14-19,25H,13H2,1H3,(H,34,36) |
| InChIKey | HVVKRFGKUFGSQO-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 547.44 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate?
The IUPAC name of methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate (CID 66912040) is methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate.
What is the SMILES notation for methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate?
The canonical SMILES for methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate is COC(=O)C(CC=Cc1ccc(N(c2ccccc2)c2ncccn2)cc1)NC(=O)c1c(Cl)cccc1Cl.
What is the InChIKey of methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate?
The InChIKey is HVVKRFGKUFGSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H24Cl2N4O3/c1-38-28(37)25(34-27(36)26-23(30)11-6-12-24(26)31)13-5-8-20-14-16-22(17-15-20)35(21-9-3-2-4-10-21)29-32-18-7-19-33-29/h2-12,14-19,25H,13H2,1H3,(H,34,36).
What are the key properties of methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate?
methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate has a molecular weight of 547.44 g/mol, XLogP of 6.63, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,6-dichlorobenzoyl)amino]-5-[4-(N-pyrimidin-2-ylanilino)phenyl]pent-4-enoate is sourced from PubChem (CID 66912040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).