C23H20Cl2N4O4 — CID 129017967
(E,2S)-2-[(2,6-dichlorobenzoyl)amino]-2-hydroxy-5-[4-[methyl(pyrimidin-2-yl)amino]phenyl]pent-4-enoic acid (PubChem CID 129017967) has the molecular formula C23H20Cl2N4O4 and a molecular weight of 487.34 g/mol. Its IUPAC name is (E,2S)-2-[(2,6-dichlorobenzoyl)amino]-2-hydroxy-5-[4-[methyl(pyrimidin-2-yl)amino]phenyl]pent-4-enoic acid.
| Compound Name | (E,2S)-2-[(2,6-dichlorobenzoyl)amino]-2-hydroxy-5-[4-[methyl(pyrimidin-2-yl)amino]phenyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 129017967 |
| Molecular Formula | C23H20Cl2N4O4 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | (E,2S)-2-[(2,6-dichlorobenzoyl)amino]-2-hydroxy-5-[4-[methyl(pyrimidin-2-yl)amino]phenyl]pent-4-enoic acid |
| SMILES | CN(c1ccc(/C=C/C[C@@](O)(NC(=O)c2c(Cl)cccc2Cl)C(=O)O)cc1)c1ncccn1 |
| InChI | InChI=1S/C23H20Cl2N4O4/c1-29(22-26-13-4-14-27-22)16-10-8-15(9-11-16)5-3-12-23(33,21(31)32)28-20(30)19-17(24)6-2-7-18(19)25/h2-11,13-14,33H,12H2,1H3,(H,28,30)(H,31,32)/b5-3+/t23-/m0/s1 |
| InChIKey | PWYJDUAHIYMXTK-OJZQOFKYSA-N |
| XLogP | 4.16 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|