C28H25Cl2N5O — CID 141149666
2,6-dichloro-N-[5-[4-[pyridin-4-ylmethyl(pyrimidin-2-yl)amino]phenyl]pent-4-enyl]benzamide (PubChem CID 141149666) has the molecular formula C28H25Cl2N5O and a molecular weight of 518.45 g/mol. Its IUPAC name is 2,6-dichloro-N-[5-[4-[pyridin-4-ylmethyl(pyrimidin-2-yl)amino]phenyl]pent-4-enyl]benzamide.
| Compound Name | 2,6-dichloro-N-[5-[4-[pyridin-4-ylmethyl(pyrimidin-2-yl)amino]phenyl]pent-4-enyl]benzamide |
|---|---|
| PubChem CID | 141149666 |
| Molecular Formula | C28H25Cl2N5O |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 2,6-dichloro-N-[5-[4-[pyridin-4-ylmethyl(pyrimidin-2-yl)amino]phenyl]pent-4-enyl]benzamide |
| SMILES | O=C(NCCCC=Cc1ccc(N(Cc2ccncc2)c2ncccn2)cc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C28H25Cl2N5O/c29-24-7-4-8-25(30)26(24)27(36)32-15-3-1-2-6-21-9-11-23(12-10-21)35(28-33-16-5-17-34-28)20-22-13-18-31-19-14-22/h2,4-14,16-19H,1,3,15,20H2,(H,32,36) |
| InChIKey | RMLIMTFEHSTRKT-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|