C27H24Cl2N6O3 — CID 163799879
(E)-5-[4-[2-cyanoethyl(pyrimidin-2-yl)amino]phenyl]-2-[(2,6-dichlorobenzoyl)amino]-N-ethenyl-1-oxopent-4-en-1-amine oxide (PubChem CID 163799879) has the molecular formula C27H24Cl2N6O3 and a molecular weight of 551.43 g/mol. Its IUPAC name is (E)-5-[4-[2-cyanoethyl(pyrimidin-2-yl)amino]phenyl]-2-[(2,6-dichlorobenzoyl)amino]-N-ethenyl-1-oxopent-4-en-1-amine oxide.
| Compound Name | (E)-5-[4-[2-cyanoethyl(pyrimidin-2-yl)amino]phenyl]-2-[(2,6-dichlorobenzoyl)amino]-N-ethenyl-1-oxopent-4-en-1-amine oxide |
|---|---|
| PubChem CID | 163799879 |
| Molecular Formula | C27H24Cl2N6O3 |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | (E)-5-[4-[2-cyanoethyl(pyrimidin-2-yl)amino]phenyl]-2-[(2,6-dichlorobenzoyl)amino]-N-ethenyl-1-oxopent-4-en-1-amine oxide |
| SMILES | C=C[NH+]([O-])C(=O)C(C/C=C/c1ccc(N(CCC#N)c2ncccn2)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H24Cl2N6O3/c1-2-35(38)26(37)23(33-25(36)24-21(28)8-4-9-22(24)29)10-3-7-19-11-13-20(14-12-19)34(18-5-15-30)27-31-16-6-17-32-27/h2-4,6-9,11-14,16-17,23,35H,1,5,10,18H2,(H,33,36)/b7-3+ |
| InChIKey | NEBAMQCHUQGWCS-XVNBXDOJSA-N |
| XLogP | 4.09 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|