C22H23Cl2NO4 — CID 76599481
methyl 2-[(2,6-dichlorobenzoyl)amino]-3-[4-(oxan-4-yl)phenyl]propanoate (PubChem CID 76599481) has the molecular formula C22H23Cl2NO4 and a molecular weight of 436.34 g/mol. Its IUPAC name is methyl 2-[(2,6-dichlorobenzoyl)amino]-3-[4-(oxan-4-yl)phenyl]propanoate.
| Compound Name | methyl 2-[(2,6-dichlorobenzoyl)amino]-3-[4-(oxan-4-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 76599481 |
| Molecular Formula | C22H23Cl2NO4 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | methyl 2-[(2,6-dichlorobenzoyl)amino]-3-[4-(oxan-4-yl)phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(C2CCOCC2)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H23Cl2NO4/c1-28-22(27)19(25-21(26)20-17(23)3-2-4-18(20)24)13-14-5-7-15(8-6-14)16-9-11-29-12-10-16/h2-8,16,19H,9-13H2,1H3,(H,25,26) |
| InChIKey | QKDFWNFBVWZFDG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |