C22H24Cl2N2O3 — CID 76599473
methyl 2-[(2,6-dichlorobenzoyl)amino]-3-(4-piperidin-4-ylphenyl)propanoate (PubChem CID 76599473) has the molecular formula C22H24Cl2N2O3 and a molecular weight of 435.35 g/mol. Its IUPAC name is methyl 2-[(2,6-dichlorobenzoyl)amino]-3-(4-piperidin-4-ylphenyl)propanoate.
| Compound Name | methyl 2-[(2,6-dichlorobenzoyl)amino]-3-(4-piperidin-4-ylphenyl)propanoate |
|---|---|
| PubChem CID | 76599473 |
| Molecular Formula | C22H24Cl2N2O3 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | methyl 2-[(2,6-dichlorobenzoyl)amino]-3-(4-piperidin-4-ylphenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(C2CCNCC2)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H24Cl2N2O3/c1-29-22(28)19(26-21(27)20-17(23)3-2-4-18(20)24)13-14-5-7-15(8-6-14)16-9-11-25-12-10-16/h2-8,16,19,25H,9-13H2,1H3,(H,26,27) |
| InChIKey | VKUJLCLKDVZFAH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |