C15H15BrN2O4 — CID 8880507
[2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(4-bromobenzoyl)amino]propanoate (PubChem CID 8880507) has the molecular formula C15H15BrN2O4 and a molecular weight of 367.20 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(4-bromobenzoyl)amino]propanoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(4-bromobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 8880507 |
| Molecular Formula | C15H15BrN2O4 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(4-bromobenzoyl)amino]propanoate |
| SMILES | C#CCNC(=O)COC(=O)[C@H](C)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H15BrN2O4/c1-3-8-17-13(19)9-22-15(21)10(2)18-14(20)11-4-6-12(16)7-5-11/h1,4-7,10H,8-9H2,2H3,(H,17,19)(H,18,20)/t10-/m0/s1 |
| InChIKey | AGWURLITQFIUNZ-JTQLQIEISA-N |
| XLogP | 0.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|