C17H21BrN2O5 — CID 8880198
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] (2S)-2-[(4-bromobenzoyl)amino]propanoate (PubChem CID 8880198) has the molecular formula C17H21BrN2O5 and a molecular weight of 413.27 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] (2S)-2-[(4-bromobenzoyl)amino]propanoate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] (2S)-2-[(4-bromobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 8880198 |
| Molecular Formula | C17H21BrN2O5 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] (2S)-2-[(4-bromobenzoyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)c1ccc(Br)cc1)C(=O)OCC(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H21BrN2O5/c1-11(20-16(22)12-4-6-13(18)7-5-12)17(23)25-10-15(21)19-9-14-3-2-8-24-14/h4-7,11,14H,2-3,8-10H2,1H3,(H,19,21)(H,20,22)/t11-,14-/m0/s1 |
| InChIKey | UUTVZXWHOKTVSM-FZMZJTMJSA-N |
| XLogP | 1.41 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |