C14H16BrNO5 — CID 8022131
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 5-bromo-2-hydroxybenzoate (PubChem CID 8022131) has the molecular formula C14H16BrNO5 and a molecular weight of 358.19 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 5-bromo-2-hydroxybenzoate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 5-bromo-2-hydroxybenzoate |
|---|---|
| PubChem CID | 8022131 |
| Molecular Formula | C14H16BrNO5 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 5-bromo-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(Br)ccc1O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H16BrNO5/c15-9-3-4-12(17)11(6-9)14(19)21-8-13(18)16-7-10-2-1-5-20-10/h3-4,6,10,17H,1-2,5,7-8H2,(H,16,18)/t10-/m0/s1 |
| InChIKey | VTFJJTSLSFYGPB-JTQLQIEISA-N |
| XLogP | 1.61 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |