C14H16BrCl3N2O2 — CID 1243139
4-bromo-N-[(1S)-2,2,2-trichloro-1-[[(2R)-oxolan-2-yl]methylamino]ethyl]benzamide (PubChem CID 1243139) has the molecular formula C14H16BrCl3N2O2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 4-bromo-N-[(1S)-2,2,2-trichloro-1-[[(2R)-oxolan-2-yl]methylamino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[(1S)-2,2,2-trichloro-1-[[(2R)-oxolan-2-yl]methylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 1243139 |
| Molecular Formula | C14H16BrCl3N2O2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 427.95 |
| IUPAC Name | 4-bromo-N-[(1S)-2,2,2-trichloro-1-[[(2R)-oxolan-2-yl]methylamino]ethyl]benzamide |
| SMILES | O=C(N[C@H](NC[C@H]1CCCO1)C(Cl)(Cl)Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H16BrCl3N2O2/c15-10-5-3-9(4-6-10)12(21)20-13(14(16,17)18)19-8-11-2-1-7-22-11/h3-6,11,13,19H,1-2,7-8H2,(H,20,21)/t11-,13+/m1/s1 |
| InChIKey | NCLSRMNJNUCELB-YPMHNXCESA-N |
| XLogP | 3.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|